CAS 1167056-60-1
:5,7-Dichloro-1H-pyrrolo[2,3-c]pyridine-3-carboxaldehyde
Description:
5,7-Dichloro-1H-pyrrolo[2,3-c]pyridine-3-carboxaldehyde is a heterocyclic organic compound characterized by its pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features two chlorine substituents at the 5 and 7 positions of the pyrrolo structure, enhancing its reactivity and potential biological activity. The presence of a carboxaldehyde functional group at the 3-position introduces a reactive aldehyde moiety, making it suitable for various chemical transformations, including condensation reactions and nucleophilic additions. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Additionally, the dichloro substitution may influence its solubility and stability in different solvents. Overall, 5,7-Dichloro-1H-pyrrolo[2,3-c]pyridine-3-carboxaldehyde is of interest for its synthetic versatility and potential utility in drug discovery and development.
Formula:C8H4Cl2N2O
InChI:InChI=1S/C8H4Cl2N2O/c9-6-1-5-4(3-13)2-11-7(5)8(10)12-6/h1-3,11H
InChI key:InChIKey=TYAALXRKDYAAMQ-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(=C(Cl)N=C(Cl)C2)NC1
Synonyms:- 5,7-Dichloro-1H-pyrrolo[2,3-c]pyridine-3-carboxaldehyde
- 1H-Pyrrolo[2,3-c]pyridine-3-carboxaldehyde, 5,7-dichloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5,7-Dichloro-1H-pyrrolo[2,3-c]pyridine-3-carbaldehyde
CAS:Formula:C8H4Cl2N2OMolecular weight:215.0362
