CAS 1167056-64-5
:Ethyl 4-hydroxy-1H-indole-6-carboxylate
Description:
Ethyl 4-hydroxy-1H-indole-6-carboxylate, identified by its CAS number 1167056-64-5, is a chemical compound that belongs to the indole family, characterized by its bicyclic structure containing a fused benzene and pyrrole ring. This compound features a carboxylate ester functional group, which contributes to its reactivity and solubility properties. The presence of a hydroxyl group at the 4-position enhances its potential for hydrogen bonding, influencing its solubility in polar solvents and its biological activity. Ethyl 4-hydroxy-1H-indole-6-carboxylate may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in synthesizing more complex molecules or as a precursor in organic synthesis. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, this compound represents a valuable entity for further research in organic and medicinal chemistry.
Formula:C11H11NO3
InChI:InChI=1S/C11H11NO3/c1-2-15-11(14)7-5-9-8(3-4-12-9)10(13)6-7/h3-6,12-13H,2H2,1H3
InChI key:InChIKey=WKJZWTBZQAKTBO-UHFFFAOYSA-N
SMILES:OC1=C2C(=CC(C(OCC)=O)=C1)NC=C2
Synonyms:- Ethyl 4-hydroxy-1H-indole-6-carboxylate
- 1H-Indole-6-carboxylic acid, 4-hydroxy-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
