CAS 1167056-66-7
:Methyl 4-cyano-1H-indazole-3-carboxylate
Description:
Methyl 4-cyano-1H-indazole-3-carboxylate is a chemical compound characterized by its indazole core, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features a cyano group (-CN) and a carboxylate ester group (-COOCH3) attached to the indazole structure, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the cyano group enhances its ability to participate in nucleophilic reactions, while the ester functionality can undergo hydrolysis or transesterification. Methyl 4-cyano-1H-indazole-3-carboxylate is often utilized in the development of pharmaceuticals and agrochemicals due to its versatile reactivity. Additionally, its molecular structure allows for various modifications, making it a valuable intermediate in the synthesis of more complex molecules. The compound is typically handled with standard safety precautions, as with many organic chemicals, to mitigate any potential hazards associated with its use.
Formula:C10H7N3O2
InChI:InChI=1S/C10H7N3O2/c1-15-10(14)9-8-6(5-11)3-2-4-7(8)12-13-9/h2-4H,1H3,(H,12,13)
InChI key:InChIKey=WQLVVPMNQTVYMQ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=2C(NN1)=CC=CC2C#N
Synonyms:- 1H-Indazole-3-carboxylic acid, 4-cyano-, methyl ester
- Methyl 4-cyano-1H-indazole-3-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
