CAS 1167056-68-9

2-Nitro-4-pyridinecarbonyl azide

Description:

2-Nitro-4-pyridinecarbonyl azide, identified by its CAS number 1167056-68-9, is a chemical compound characterized by the presence of both a nitro group and an azide functional group attached to a pyridine ring. This compound typically exhibits a yellow to orange crystalline appearance, indicative of its nitro substituent. It is known for its potential applications in organic synthesis and as a precursor in the preparation of various nitrogen-containing compounds. The azide group contributes to its reactivity, making it a useful intermediate in click chemistry and other synthetic methodologies. Additionally, the presence of the pyridine ring can influence its solubility and reactivity, often making it soluble in polar organic solvents. Safety considerations are paramount when handling this compound, as azides can be sensitive to heat and shock, posing risks of detonation under certain conditions. Overall, 2-Nitro-4-pyridinecarbonyl azide is a valuable compound in the field of organic chemistry, particularly in the development of new materials and pharmaceuticals.

Formula: C₆H₃N₅O₃

InChI: InChI=1S/C6H3N5O3/c7-10-9-6(12)4-1-2-8-5(3-4)11(13)14/h1-3H

InChI key: InChIKey=MNFWMAYARBCQFC-UHFFFAOYSA-N

SMILES: C(N=[N+]=[N-])(=O)C=1C=C(N(=O)=O)N=CC1

Synonyms:

• 4-Pyridinecarbonyl azide, 2-nitro-
• 2-Nitro-4-pyridinecarbonyl azide