CymitQuimica logo

CAS 1167056-73-6

:

Ethyl 2-fluoro-4-oxazolecarboxylate

Description:
Ethyl 2-fluoro-4-oxazolecarboxylate is a chemical compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. The presence of a fluorine atom at the 2-position of the oxazole ring contributes to its unique reactivity and potential applications in medicinal chemistry and agrochemicals. The ethyl ester functional group enhances its solubility in organic solvents, making it suitable for various synthetic processes. This compound is typically used as an intermediate in the synthesis of more complex molecules, particularly in the development of pharmaceuticals. Its properties, such as boiling point, melting point, and reactivity, can vary based on the specific conditions and the presence of other functional groups in a reaction. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure safe laboratory practices. Overall, Ethyl 2-fluoro-4-oxazolecarboxylate is a valuable compound in organic synthesis with diverse applications.
Formula:C6H6FNO3
InChI:InChI=1S/C6H6FNO3/c1-2-10-5(9)4-3-11-6(7)8-4/h3H,2H2,1H3
InChI key:InChIKey=SMFBBQOOWDPUQN-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=COC(F)=N1
Synonyms:
  • 4-Oxazolecarboxylic acid, 2-fluoro-, ethyl ester
  • Ethyl 2-fluoro-4-oxazolecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.