CAS 1167056-75-8

2-Cyano-4-oxazolecarboxylic acid

Description:

2-Cyano-4-oxazolecarboxylic acid is an organic compound characterized by its oxazole ring structure, which features a five-membered heterocyclic ring containing both nitrogen and oxygen atoms. This compound contains a cyano group (-CN) and a carboxylic acid group (-COOH), contributing to its reactivity and potential applications in various chemical reactions. The presence of the cyano group enhances its ability to participate in nucleophilic addition reactions, while the carboxylic acid group can engage in acid-base chemistry. 2-Cyano-4-oxazolecarboxylic acid is often studied for its potential use in pharmaceuticals and agrochemicals due to its bioactive properties. Additionally, its unique structure allows for the exploration of its derivatives, which may exhibit varied biological activities. The compound is typically handled with standard laboratory safety precautions, as with many organic chemicals, to mitigate any risks associated with its reactivity and potential toxicity. Overall, 2-Cyano-4-oxazolecarboxylic acid is a valuable compound in synthetic organic chemistry and medicinal chemistry research.

Formula: C₅H₂N₂O₃

InChI: InChI=1S/C5H2N2O3/c6-1-4-7-3(2-10-4)5(8)9/h2H,(H,8,9)

InChI key: InChIKey=RQPSVFCMIPHUJR-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1N=C(C#N)OC1

Synonyms:

• 4-Oxazolecarboxylic acid, 2-cyano-
• 2-Cyano-4-oxazolecarboxylic acid

4-Oxazolecarboxylic acid, 2-cyano-

CAS: 1167056-75-8

Formula: C₅H₂N₂O₃

Molecular weight: 138.081

Ref: IN-DA000D3M