CAS 1167056-77-0
:2-Fluoro-5-thiazolecarboxylic acid
Description:
2-Fluoro-5-thiazolecarboxylic acid is a heterocyclic organic compound characterized by the presence of a thiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. The compound features a carboxylic acid functional group (-COOH) and a fluorine atom at the 2-position of the thiazole ring, contributing to its unique chemical properties. This structure imparts both polar and non-polar characteristics, influencing its solubility and reactivity. The presence of the fluorine atom can enhance the compound's biological activity and stability, making it of interest in pharmaceutical applications. Additionally, the thiazole moiety is often associated with various biological activities, including antimicrobial and anti-inflammatory properties. The compound's synthesis typically involves the introduction of the fluorine atom and the formation of the thiazole ring through specific chemical reactions. Overall, 2-Fluoro-5-thiazolecarboxylic acid is notable for its potential applications in medicinal chemistry and its role as an intermediate in the synthesis of other complex organic molecules.
Formula:C4H2FNO2S
InChI:InChI=1S/C4H2FNO2S/c5-4-6-1-2(9-4)3(7)8/h1H,(H,7,8)
InChI key:InChIKey=GFFAXZZAXYPCMP-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1SC(F)=NC1
Synonyms:- 2-Fluoro-5-thiazolecarboxylic acid
- 5-Thiazolecarboxylic acid, 2-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
