CymitQuimica logo

CAS 1167056-82-7

:

4-Chloro-6-methoxy-7-methyl-1H-indole

Description:
4-Chloro-6-methoxy-7-methyl-1H-indole is an organic compound belonging to the indole family, characterized by its bicyclic structure that includes a fused benzene and pyrrole ring. This compound features a chlorine atom at the 4-position, a methoxy group (-OCH3) at the 6-position, and a methyl group (-CH3) at the 7-position of the indole ring. These substituents contribute to its unique chemical properties, influencing its reactivity and potential applications. The presence of the chlorine atom can enhance the compound's electrophilic character, while the methoxy group may provide electron-donating effects, affecting its overall stability and solubility in various solvents. 4-Chloro-6-methoxy-7-methyl-1H-indole may exhibit biological activity, making it of interest in pharmaceutical research. Its synthesis typically involves multi-step organic reactions, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. Overall, this compound represents a valuable entity in the study of indole derivatives and their applications in medicinal chemistry.
Formula:C10H10ClNO
InChI:InChI=1S/C10H10ClNO/c1-6-9(13-2)5-8(11)7-3-4-12-10(6)7/h3-5,12H,1-2H3
InChI key:InChIKey=KYPKCHNJPQNLBP-UHFFFAOYSA-N
SMILES:CC1=C2C(=C(Cl)C=C1OC)C=CN2
Synonyms:
  • 4-Chloro-6-methoxy-7-methyl-1H-indole
  • 1H-Indole, 4-chloro-6-methoxy-7-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.