CAS 1167056-86-1

6-Bromo-5-methoxy-1H-pyrrolo[2,3-b]pyridine

Description:

6-Bromo-5-methoxy-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyridine ring fused to a pyrrole ring. The presence of a bromine atom at the 6-position and a methoxy group at the 5-position contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both halogen and methoxy functionalities, which can influence pharmacokinetics and receptor interactions. Additionally, the compound may exhibit interesting electronic properties due to the conjugated system formed by the fused rings. As with many heterocycles, it may also participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, making it a valuable intermediate in organic synthesis. Safety and handling precautions should be observed, as with all chemical substances, particularly those with halogen substituents.

Formula: C₈H₇BrN₂O

InChI: InChI=1S/C8H7BrN2O/c1-12-6-4-5-2-3-10-8(5)11-7(6)9/h2-4H,1H3,(H,10,11)

InChI key: InChIKey=CFZHYMZHSXJEHV-UHFFFAOYSA-N

SMILES: O(C)C=1C=C2C(=NC1Br)NC=C2

Synonyms:

• 6-Bromo-5-methoxy-1H-pyrrolo[2,3-b]pyridine
• 1H-Pyrrolo[2,3-b]pyridine, 6-bromo-5-methoxy-

6-bromo-5-methoxy-1H-pyrrolo[2,3-b]pyridine

CAS: 1167056-86-1

Formula: C₈H₇BrN₂O

Molecular weight: 227.0580

Ref: IN-DA000D4L