CAS 116707-08-5

2-Fluoro-α-(1-methylethyl)benzenemethanol

Description:

2-Fluoro-α-(1-methylethyl)benzenemethanol, with the CAS number 116707-08-5, is an organic compound characterized by the presence of a fluorine atom and a benzenemethanol structure. This compound features a fluoro substituent at the 2-position of the aromatic ring, which influences its reactivity and polarity. The α-(1-methylethyl) group, also known as an isopropyl group, contributes to the compound's hydrophobic characteristics, affecting its solubility in various solvents. The presence of the hydroxyl (-OH) group in the benzenemethanol structure imparts alcohol-like properties, making it capable of hydrogen bonding, which can enhance its solubility in polar solvents. The combination of these functional groups suggests potential applications in pharmaceuticals or as intermediates in organic synthesis. Additionally, the fluorine atom may enhance the compound's stability and alter its biological activity compared to non-fluorinated analogs. Overall, the unique structural features of 2-Fluoro-α-(1-methylethyl)benzenemethanol contribute to its distinct chemical behavior and potential utility in various chemical applications.

Formula: C₁₀H₁₃FO

InChI: InChI=1S/C10H13FO/c1-7(2)10(12)8-5-3-4-6-9(8)11/h3-7,10,12H,1-2H3

InChI key: InChIKey=CAPFSSPGUHTLSJ-UHFFFAOYSA-N

SMILES: C(C(C)C)(O)C1=C(F)C=CC=C1

Synonyms:

• 1-(2-Fluorophenyl)-2-methylpropan-1-ol
• 2-Fluoro-α-(1-methylethyl)benzenemethanol
• Benzenemethanol, 2-fluoro-α-(1-methylethyl)-