CymitQuimica logo

CAS 116730-80-4

:

methyl 6'-deoxy-6'-fluoroisomaltoside

Description:
Methyl 6'-deoxy-6'-fluoroisomaltoside is a synthetic carbohydrate derivative characterized by the presence of a methyl group and a fluorine atom at the 6' position of the isomaltoside structure. This compound is a glycoside, which means it consists of a sugar moiety linked to a non-sugar moiety via a glycosidic bond. The introduction of the fluorine atom can influence the compound's biological activity, stability, and solubility compared to its non-fluorinated counterparts. Methyl 6'-deoxy-6'-fluoroisomaltoside may exhibit unique properties that make it useful in various applications, including biochemical research and pharmaceutical development. Its structural modifications can affect interactions with enzymes and receptors, potentially leading to altered metabolic pathways. As with many glycosides, it may also have implications in studies related to glycosylation processes, carbohydrate metabolism, and the development of glycosylated drugs. However, specific physical and chemical properties such as melting point, solubility, and reactivity would require empirical data for precise characterization.
Formula:C13H23FO10
InChI:InChI=1/C13H23FO10/c1-21-12-10(19)9(18)7(16)5(24-12)3-22-13-11(20)8(17)6(15)4(2-14)23-13/h4-13,15-20H,2-3H2,1H3/t4-,5-,6-,7-,8+,9+,10-,11-,12+,13+/m1/s1
Synonyms:
  • Mdfim
  • methyl 6-O-(6-deoxy-6-fluoro-alpha-D-glucopyranosyl)-alpha-D-glucopyranoside
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.