CAS 116734-15-7
:2-(4-HYDROXY-PHENYL)-6-METHYL-QUINOLINE-4-CARBOXYLIC ACID
Description:
2-(4-Hydroxy-phenyl)-6-methyl-quinoline-4-carboxylic acid, with the CAS number 116734-15-7, is an organic compound characterized by its quinoline structure, which features a fused bicyclic system containing a nitrogen atom. This compound exhibits both acidic and phenolic properties due to the presence of a carboxylic acid group and a hydroxyl group on the aromatic ring. The methyl group at the 6-position contributes to its hydrophobic characteristics, potentially influencing its solubility and reactivity. The hydroxyl group can participate in hydrogen bonding, enhancing its interactions with other molecules. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs or as a potential therapeutic agent. Its unique structural features may also lend themselves to applications in materials science or as a dye. As with many organic compounds, its stability, reactivity, and potential applications can be influenced by environmental factors such as pH and temperature.
Formula:C17H13NO3
InChI:InChI=1/C17H13NO3/c1-10-2-7-15-13(8-10)14(17(20)21)9-16(18-15)11-3-5-12(19)6-4-11/h2-9,19H,1H3,(H,20,21)
SMILES:Cc1ccc2c(c1)c(cc(c1ccc(cc1)O)n2)C(=O)O
Synonyms:- 4-Quinolinecarboxylic Acid, 2-(4-Hydroxyphenyl)-6-Methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
