CAS 116734-19-1

6-chloro-2-(4-hydroxyphenyl)quinoline-4-carboxylic acid

Description:

6-Chloro-2-(4-hydroxyphenyl)quinoline-4-carboxylic acid is a chemical compound characterized by its quinoline structure, which features a chlorine atom and a hydroxyl group on the aromatic rings. This compound typically exhibits properties associated with both acidic and aromatic functionalities, making it potentially useful in various chemical applications, including pharmaceuticals and organic synthesis. The presence of the carboxylic acid group contributes to its acidic nature, while the hydroxyl group can participate in hydrogen bonding, influencing its solubility and reactivity. The chlorine substituent may enhance the compound's biological activity or alter its electronic properties. Additionally, the compound's structure suggests potential for interactions with biological targets, which could be explored in medicinal chemistry. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the conditions under which it is studied. Overall, this compound represents a unique combination of functional groups that may offer diverse applications in research and industry.

Formula: C₁₆H₁₀ClNO₃

InChI: InChI=1/C16H10ClNO3/c17-10-3-6-14-12(7-10)13(16(20)21)8-15(18-14)9-1-4-11(19)5-2-9/h1-8,19H,(H,20,21)

SMILES: c1cc(ccc1c1cc(c2cc(ccc2n1)Cl)C(=O)O)O

Synonyms:

• 4-Quinolinecarboxylic Acid, 6-Chloro-2-(4-Hydroxyphenyl)-

6-Chloro-2-(4-hydroxyphenyl)quinoline-4-carboxylic acid

CAS: 116734-19-1

Formula: C₁₆H₁₀ClNO₃

Molecular weight: 299.7085

Ref: IN-DA000D4Z