CAS 1167441-29-3
:2-(1-Naphthalenylamino)butanoic acid hydrazide
Description:
2-(1-Naphthalenylamino)butanoic acid hydrazide, identified by its CAS number 1167441-29-3, is a chemical compound that features a hydrazide functional group linked to a butanoic acid moiety and a naphthalenyl amino group. This compound is characterized by its potential biological activity, which may include anti-inflammatory or anticancer properties, although specific studies would be necessary to confirm such effects. The presence of the naphthalene ring contributes to its aromatic characteristics, potentially influencing its solubility and interaction with biological systems. The hydrazide functional group can participate in various chemical reactions, making this compound of interest in medicinal chemistry and drug development. Additionally, the structural features suggest that it may exhibit specific stereochemical properties, which could affect its biological activity and pharmacokinetics. Overall, 2-(1-Naphthalenylamino)butanoic acid hydrazide represents a unique structure that warrants further investigation for its potential applications in pharmaceuticals and biochemistry.
Formula:C14H17N3O
InChI:InChI=1S/C14H17N3O/c1-2-12(14(18)17-15)16-13-9-5-7-10-6-3-4-8-11(10)13/h3-9,12,16H,2,15H2,1H3,(H,17,18)
InChI key:InChIKey=HDEMHSNWVYEFSC-UHFFFAOYSA-N
SMILES:N(C(C(NN)=O)CC)C=1C2=C(C=CC1)C=CC=C2
Synonyms:- 2-(1-Naphthylamino)butanohydrazide
- Butanoic acid, 2-(1-naphthalenylamino)-, hydrazide
- 2-(1-Naphthalenylamino)butanoic acid hydrazide
- 2-(Naphthalen-1-ylamino)butanehydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.