CAS 116747-79-6
:bis-homotris
Description:
Bis-homotris, identified by its CAS number 116747-79-6, is a chemical compound that belongs to a class of substances known for their unique structural and functional properties. While specific details about bis-homotris may not be widely documented, compounds with similar nomenclature often exhibit characteristics such as being used in specialized applications, including materials science and organic synthesis. Typically, such compounds may possess multiple functional groups, which can influence their reactivity and interactions with other substances. They may also demonstrate interesting physical properties, such as solubility in various solvents, melting and boiling points, and stability under different conditions. The study of bis-homotris and its derivatives could provide insights into potential applications in pharmaceuticals, agrochemicals, or advanced materials. For precise applications and safety information, consulting specific scientific literature or safety data sheets is recommended, as these resources provide detailed insights into the compound's behavior and handling requirements.
Formula:C10H23NO3
InChI:InChI=1/C10H23NO3/c11-10(4-1-7-12,5-2-8-13)6-3-9-14/h12-14H,1-9,11H2
SMILES:C(CC(CCCO)(CCCO)N)CO
Synonyms:- Tris(3-Hydroxypropyl)Aminomethane
- 4-Amino-4-(3-Hydroxypropyl)Heptane-1,7-Diol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.