CAS 116751-24-7
:3-Hydroxy-2,4,5-trifluorobenzoic acid
Description:
3-Hydroxy-2,4,5-trifluorobenzoic acid is an aromatic compound characterized by the presence of a benzoic acid structure with three fluorine substituents and a hydroxyl group. The trifluoromethyl groups at the 2, 4, and 5 positions significantly influence its chemical properties, enhancing its acidity and potentially affecting its reactivity and solubility in various solvents. The hydroxyl group contributes to its ability to form hydrogen bonds, which can enhance its solubility in polar solvents. This compound is likely to exhibit strong acidity due to the electron-withdrawing effects of the fluorine atoms, which stabilize the carboxylate ion formed upon deprotonation. Additionally, the presence of multiple fluorine atoms may impart unique biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in agrochemicals or as an intermediate in organic synthesis. Safety data should be consulted for handling, as fluorinated compounds can exhibit specific toxicological profiles.
Formula:C7H2F3O3
InChI:InChI=1/C7H3F3O3/c8-3-1-2(7(12)13)4(9)6(11)5(3)10/h1,11H,(H,12,13)/p-1
SMILES:c1c(c(c(c(c1F)F)[O-])F)C(=O)O
Synonyms:- 2,4,5-Trifluoro-3-hydroxybenzoic acid
- 3-Hydroxy-2,4,5-Trifluoro Benzoic Acid
- 2,4,5-Trifluoro-3-hydroxybenzoicacid
- 2,4,5-Trifluoro-3-Hydroxy Benzoic Acid
- 2,4,5-Trifluoro-3-Hydroxybenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,4,5-Trifluoro-3-hydroxybenzoic Acid
CAS:Formula:C7H3F3O3Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:192.09Benzoic acid, 2,4,5-trifluoro-3-hydroxy-
CAS:Formula:C7H3F3O3Purity:98%Color and Shape:SolidMolecular weight:192.09213-Hydroxy-2,4,5-trifluorobenzoic acid
CAS:3-Hydroxy-2,4,5-trifluorobenzoic acidFormula:C7H3F3O3Purity:98%Color and Shape: off-white/faint beige solidMolecular weight:192.09g/mol3-Hydroxy-2,4,5-trifluorobenzoic acid
CAS:Formula:C7H3F3O3Purity:98%Color and Shape:SolidMolecular weight:192.0933-Hydroxy-2,4,5-trifluorobenzoic acid
CAS:3-Hydroxy-2,4,5-trifluorobenzoic acid is a decarboxylated form of 3-hydroxybenzoic acid. It is a synthetic compound that has the acidic properties of benzoic acid. The methyl ethyl group can be converted to the chloride in order to make it soluble in water. 3-Hydroxy-2,4,5-trifluorobenzoic acid is used as an antimicrobial agent and medicines for the treatment of bacterial infections such as pneumonia and bronchitis. In addition, this chemical is used as a reagent for organic synthesis reactions because it reacts with hydrogen fluoride to produce fluorine gas.Formula:C7H3F3O3Purity:Min. 95%Molecular weight:192.09 g/mol





