CymitQuimica logo

CAS 116751-24-7

:

3-Hydroxy-2,4,5-trifluorobenzoic acid

Description:
3-Hydroxy-2,4,5-trifluorobenzoic acid is an aromatic compound characterized by the presence of a benzoic acid structure with three fluorine substituents and a hydroxyl group. The trifluoromethyl groups at the 2, 4, and 5 positions significantly influence its chemical properties, enhancing its acidity and potentially affecting its reactivity and solubility in various solvents. The hydroxyl group contributes to its ability to form hydrogen bonds, which can enhance its solubility in polar solvents. This compound is likely to exhibit strong acidity due to the electron-withdrawing effects of the fluorine atoms, which stabilize the carboxylate ion formed upon deprotonation. Additionally, the presence of multiple fluorine atoms may impart unique biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in agrochemicals or as an intermediate in organic synthesis. Safety data should be consulted for handling, as fluorinated compounds can exhibit specific toxicological profiles.
Formula:C7H2F3O3
InChI:InChI=1/C7H3F3O3/c8-3-1-2(7(12)13)4(9)6(11)5(3)10/h1,11H,(H,12,13)/p-1
InChI key:YYAFUGSJSHXYNK-UHFFFAOYSA-N
SMILES:c1c(c(c(c(c1F)F)[O-])F)C(=O)O
Synonyms:
  • 2,4,5-Trifluoro-3-hydroxybenzoic acid
  • 3-Hydroxy-2,4,5-Trifluoro Benzoic Acid
  • 2,4,5-Trifluoro-3-hydroxybenzoicacid
  • 2,4,5-Trifluoro-3-Hydroxy Benzoic Acid
  • 2,4,5-Trifluoro-3-Hydroxybenzoate
Found 8 products.