CAS 116759-35-4: α-[3-(Hexylmethylamino)propyl]-3,4,5-trimethoxy-α-(1-methylethyl)benzeneacetonitrile
Description:α-[3-(Hexylmethylamino)propyl]-3,4,5-trimethoxy-α-(1-methylethyl)benzeneacetonitrile, with CAS number 116759-35-4, is a synthetic organic compound characterized by its complex structure, which includes multiple functional groups. This compound features a benzene ring substituted with three methoxy groups, contributing to its potential for various chemical interactions. The presence of a nitrile group (acetonitrile) indicates that it may exhibit polar characteristics, influencing its solubility in organic solvents. The hexylmethylamino side chain suggests that it may possess amphiphilic properties, which could affect its behavior in biological systems or as a surfactant. Additionally, the presence of isopropyl groups may enhance its hydrophobic characteristics. Overall, this compound's unique structural features may confer specific biological activities or applications in medicinal chemistry, though detailed studies would be necessary to elucidate its precise properties and potential uses. As with any chemical substance, safety and handling precautions should be observed, particularly due to the presence of nitrogen and potential biological activity.
Formula:C24H40N2O3
InChI:InChI=1S/C24H40N2O3/c1-8-9-10-11-14-26(4)15-12-13-24(18-25,19(2)3)20-16-21(27-5)23(29-7)22(17-20)28-6/h16-17,19H,8-15H2,1-7H3
InChI key:InChIKey=SKDZEFVVFACNLS-UHFFFAOYSA-N
SMILES:N#CC(C1=CC(OC)=C(OC)C(OC)=C1)(CCCN(C)CCCCCC)C(C)C
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Nexopamil racemate REF: TM-T12215CAS: 116759-35-4 | 98.61% | 665.00 €~1,710.00 € | Tue 22 Apr 25 |
![]() | Nexopamil racemate REF: 3D-REA75935CAS: 116759-35-4 | Min. 95% | - - - | Discontinued product |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Nexopamil racemate
Ref: TM-T12215
1mg | 665.00 € | ||
5mg | 1,710.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Nexopamil racemate
Ref: 3D-REA75935
Undefined size | Discontinued | Request information | |
1mg | Discontinued | Request information | |
5mg | Discontinued | Request information | |
10mg | Discontinued | Request information |