CAS 116779-75-0
:1-Bromo-1-ethoxyethane
Description:
1-Bromo-1-ethoxyethane, also known as ethyl bromoethyl ether, is an organic compound characterized by the presence of a bromine atom and an ethoxy group attached to a two-carbon ethane backbone. It is typically a colorless to pale yellow liquid with a distinctive odor. This compound is classified as an ether and is known for its moderate volatility and solubility in organic solvents, while being less soluble in water. The presence of the bromine atom makes it a reactive species, often used in organic synthesis as an alkylating agent. Its reactivity can facilitate various chemical transformations, including nucleophilic substitution reactions. Safety considerations are important when handling this compound, as it may pose health risks through inhalation or skin contact. Proper storage in a cool, dry place away from light is recommended to maintain its stability. Overall, 1-bromo-1-ethoxyethane serves as a useful intermediate in the synthesis of more complex organic molecules in the field of organic chemistry.
Formula:C4H9BrO
InChI:InChI=1S/C4H9BrO/c1-3-6-4(2)5/h4H,3H2,1-2H3
InChI key:InChIKey=DGWGSHNCXHQSFP-UHFFFAOYSA-N
SMILES:O(C(Br)C)CC
Synonyms:- 1-Bromo-1-ethoxyethane
- α-Bromoethyl ethyl ether
- Ethane, 1-bromo-1-ethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
