
CAS 116784-82-8
:N-(4-Aminobutyl)-2-furancarboxamide
Description:
N-(4-Aminobutyl)-2-furancarboxamide, also known by its CAS number 116784-82-8, is an organic compound characterized by the presence of a furan ring and an amine functional group. This substance features a butyl chain linked to an amino group, which contributes to its potential biological activity. The furan moiety is a five-membered aromatic ring containing oxygen, which can participate in various chemical reactions, including electrophilic substitutions. The amine group enhances the compound's solubility in polar solvents and may facilitate interactions with biological targets, making it of interest in medicinal chemistry. Its structural characteristics suggest potential applications in pharmaceuticals, particularly in the development of compounds with neuroprotective or anti-inflammatory properties. Additionally, the presence of both hydrophilic and hydrophobic regions in its structure may influence its pharmacokinetic properties, such as absorption and distribution in biological systems. Overall, N-(4-Aminobutyl)-2-furancarboxamide represents a compound with intriguing chemical properties and potential therapeutic applications.
Formula:C9H14N2O2
InChI:InChI=1S/C9H14N2O2/c10-5-1-2-6-11-9(12)8-4-3-7-13-8/h3-4,7H,1-2,5-6,10H2,(H,11,12)
InChI key:InChIKey=NIOYNJLZTWESHG-UHFFFAOYSA-N
SMILES:C(NCCCCN)(=O)C1=CC=CO1
Synonyms:- 2-Furancarboxamide, N-(4-aminobutyl)-
- N-(4-Aminobutyl)-2-furancarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.