CAS 116797-81-0

N-Hydroxy-2-methoxy-N-methylethanamine

Description:

N-Hydroxy-2-methoxy-N-methylethanamine, with the CAS number 116797-81-0, is an organic compound characterized by the presence of a hydroxyl group (-OH) and a methoxy group (-OCH3) attached to an ethanamine backbone. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds due to the hydroxyl group. It is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the methoxy group can influence its solubility in organic solvents and water, often enhancing its lipophilicity. N-Hydroxy-2-methoxy-N-methylethanamine may also participate in various chemical reactions, including those typical of hydroxyl and amine functionalities, such as nucleophilic substitutions and condensation reactions. Its applications may span across fields such as pharmaceuticals, agrochemicals, or as a reagent in organic synthesis, although specific uses would depend on further research and development. Safety data should be consulted for handling and storage guidelines.

Formula: C₄H₁₁NO₂

InChI: InChI=1S/C4H11NO2/c1-5(6)3-4-7-2/h6H,3-4H2,1-2H3

InChI key: InChIKey=IHDXZTFCGLVYNG-UHFFFAOYSA-N

SMILES: C(N(C)O)COC

Synonyms:

• Ethanamine, N-hydroxy-2-methoxy-N-methyl-
• N-Hydroxy-2-methoxy-N-methylethanamine