CAS 116799-18-9

2-furan-2-yl-8,9-dihydro-7H-cyclopenta[e][1,2,4]triazolo[1,5-c]pyrimidin-5-amine

Description:

2-Furan-2-yl-8,9-dihydro-7H-cyclopenta[e][1,2,4]triazolo[1,5-c]pyrimidin-5-amine is a heterocyclic compound characterized by its complex fused ring structure, which includes a furan ring and a triazolo-pyrimidine moiety. This compound typically exhibits properties such as moderate solubility in polar solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the amine functional group suggests it may engage in hydrogen bonding, influencing its reactivity and interactions with biological targets. Its unique structural features may contribute to specific pharmacological activities, potentially including anti-inflammatory or anticancer effects, although detailed biological evaluations would be necessary to confirm such activities. The compound's molecular structure allows for various modifications, which could enhance its therapeutic profile or selectivity. Overall, 2-furan-2-yl-8,9-dihydro-7H-cyclopenta[e][1,2,4]triazolo[1,5-c]pyrimidin-5-amine represents a class of compounds that may hold promise in drug development and research applications.

Formula: C₁₂H₁₁N₅O

InChI: InChI=1/C12H11N5O/c13-12-14-8-4-1-3-7(8)11-15-10(16-17(11)12)9-5-2-6-18-9/h2,5-6H,1,3-4H2,(H2,13,14)

Cgs 21197

CAS: 116799-18-9

Cgs 21197 is an adenosine A2 receptor antagonist.

Formula: C₁₂H₁₁N₅O

Color and Shape: Solid

Molecular weight: 241.25

Ref: TM-T71345