CymitQuimica logo

CAS 1167991-22-1

:

3-Bromo-2-phenoxypyridine

Description:
3-Bromo-2-phenoxypyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 3-position and a phenoxy group at the 2-position contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent used. It is often utilized in organic synthesis and medicinal chemistry, particularly as an intermediate in the development of pharmaceuticals or agrochemicals. The bromine substituent can participate in nucleophilic substitution reactions, while the phenoxy group can influence the compound's electronic properties and steric effects. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed. Overall, 3-Bromo-2-phenoxypyridine is an important compound in various chemical applications, reflecting the diverse functionalities that can be achieved through strategic substitution on the pyridine ring.
Formula:C11H8BrNO
InChI:InChI=1S/C11H8BrNO/c12-10-7-4-8-13-11(10)14-9-5-2-1-3-6-9/h1-8H
InChI key:InChIKey=UAGNHWZDNVZCTN-UHFFFAOYSA-N
SMILES:O(C1=C(Br)C=CC=N1)C2=CC=CC=C2
Synonyms:
  • 3-Bromo-2-phenoxypyridine
  • Pyridine, 3-bromo-2-phenoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.