CAS 1168-00-9
:2,9,10-trimethoxy-5,13a-dihydro-6H-isoquino[3,2-a]isoquinolin-3-ol
Description:
2,9,10-trimethoxy-5,13a-dihydro-6H-isoquino[3,2-a]isoquinolin-3-ol, with CAS number 1168-00-9, is a complex organic compound belonging to the isoquinoline family. This substance features a fused bicyclic structure that incorporates both isoquinoline and isoquinolinone moieties, contributing to its unique chemical properties. The presence of three methoxy groups (-OCH3) significantly influences its solubility and reactivity, enhancing its potential for various biological activities. The hydroxyl group (-OH) at the 3-position adds to its polar character, which can affect its interaction with biological targets. This compound has garnered interest in medicinal chemistry due to its potential pharmacological properties, including anti-inflammatory and neuroprotective effects. Its structural complexity and functional groups suggest that it may participate in various chemical reactions, including alkylation and oxidation. However, detailed studies are necessary to fully elucidate its biological mechanisms and therapeutic potential. Overall, 2,9,10-trimethoxy-5,13a-dihydro-6H-isoquino[3,2-a]isoquinolin-3-ol represents a fascinating subject for further research in organic and medicinal chemistry.
Formula:C20H20INO4
InChI:InChI=1/C20H19NO4.ClH/c1-23-18-5-4-12-8-16-14-10-19(24-2)17(22)9-13(14)6-7-21(16)11-15(12)20(18)25-3;/h4-5,8-11H,6-7H2,1-3H3;1H/p+1
Synonyms:- Jatrorrhizine hydrochloride
- Jatrorrhizine Hcl(Rg)
- Dibenzo[a,g]quinolizinium,5,6-dihydro-3-hydroxy-2,9,10-trimethoxy-, iodide (9CI)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Dibenzo[a,g]quinolizinium, 5,6-dihydro-3-hydroxy-2,9,10-trimethoxy-, iodide (9CI)
CAS:Formula:C20H20INO4Molecular weight:465.2816Jatrorrhizine Iodide
CAS:Controlled ProductApplications Jatrorrhizine iodide, is an alkaloid extract from the Berberidaceae family of plants displaying antioxidant activity.
References Ruiz, A. et al.: J. Agri. Food Chem., 62, 12407 (2014); Kim, J. et al.: Bioorg. Med. Chem., 22, 6047 (2014);Formula:C20H20NO4·IColor and Shape:NeatMolecular weight:465.28Jatrorrhizine iodide
CAS:Jatrorrhizine iodide is an isoquinoline alkaloid compound, which is sourced from various medicinal plants such as those in the Berberidaceae family. This compound exerts its effects by interfering with cellular processes, primarily through modulation of specific signaling pathways and inhibition of cell proliferation. Its mode of action includes the alteration of gene expression and induction of apoptosis in certain cancer cell lines, as well as disruption of microbial cell membrane integrity in various bacterial strains.Formula:C20H20INO4Purity:Min. 95%Color and Shape:PowderMolecular weight:465.28 g/mol


