CAS 116815-03-3: 8-chloro-1,2,3,4-tetrahydro-benzo[b]azepin-5-one

Description:8-Chloro-1,2,3,4-tetrahydro-benzo[b]azepin-5-one is a chemical compound characterized by its bicyclic structure, which includes a seven-membered azepine ring fused to a benzene ring. The presence of a chlorine atom at the 8-position and a carbonyl group at the 5-position contributes to its unique reactivity and potential biological activity. This compound is typically classified as a heterocyclic organic compound due to the incorporation of nitrogen in its ring structure. It may exhibit properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many heterocycles. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as similar compounds have been explored for their therapeutic effects. Additionally, the presence of the chloro substituent may influence its interaction with biological targets, making it a subject of interest in drug design and synthesis. As with any chemical substance, safety and handling precautions should be observed due to its potential biological activity.

Formula:C₁₀H₁₀ClNO

InChI:InChI=1/C10H10ClNO/c11-7-3-4-8-9(6-7)12-5-1-2-10(8)13/h3-4,6,12H,1-2,5H2

Synonyms:
8-Chloro-1,2,3,4-Tetrahydrobenzo[B]Azepin-5-One
8-chloro-1,2,3,4-tetrahydro-5H-1-benzazepin-5-one

Found 4 products.

Product data	Purity	Price range	Estimated delivery
5H-1-Benzazepin-5-one, 8-chloro-1,2,3,4-tetrahydro- REF: IN-DA000D9RCAS: 116815-03-3	- - -	To inquire	Tue 04 Mar 25
Tolvaptan Impurity 49 REF: 4Z-T-6954CAS: 116815-03-3	- - -	To inquire	Tue 11 Mar 25
8-Chloro-1,2,3,4-tetrahydro-5H-benzo[b]azepin-5-one REF: 10-F606369CAS: 116815-03-3	95+%	To inquire	Wed 12 Mar 25
8-Chloro-1,2,3,4-tetrahydro-benzo[b]azepin-5-one REF: 3D-FC171757CAS: 116815-03-3	Min. 95%	- - -	Discontinued product