CAS 116817-13-1
:2-Thiophenepropanamine,N-methyl-g-(1-naphthalenyloxy)-
Description:
2-Thiophenepropanamine, N-methyl-g-(1-naphthalenyloxy)-, identified by CAS number 116817-13-1, is a chemical compound that features a thiophene ring, an amine group, and a naphthalenyl ether moiety. This compound is characterized by its unique structural components, which contribute to its potential biological activity and applications in medicinal chemistry. The presence of the thiophene ring may impart specific electronic properties and enhance interactions with biological targets, while the naphthalenyloxy group can influence lipophilicity and solubility. As an amine, it may participate in hydrogen bonding and act as a potential ligand in various chemical reactions. The compound's properties, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the nature of its substituents. Overall, this compound may be of interest in the development of pharmaceuticals or agrochemicals, although specific biological activities and applications would require further investigation through experimental studies.
Formula:C18H19NOS
InChI:InChI=1S/C18H19NOS/c1-19-12-11-17(18-10-5-13-21-18)20-16-9-4-7-14-6-2-3-8-15(14)16/h2-10,13,17,19H,11-12H2,1H3
InChI key:InChIKey=ZEUITGRIYCTCEM-UHFFFAOYSA-N
SMILES:O(C(CCNC)C1=CC=CS1)C=2C3=C(C=CC2)C=CC=C3
Synonyms:- (?à)-Duloxetine
- (±)-Duloxetine
- N-Methyl-3-(1-naphthoxy)-3-(2-thienyl)propylamine
- N-Methyl-γ-(1-naphthalenyloxy)-2-thiophenepropanamine
- 2-Thiophenepropanamine, N-methyl-γ-(1-naphthalenyloxy)-
- Duloxetine Racemic Mixture Q: What is the CAS Number of
- rac-Duloxetine D7Q: What is
- Duloxetine Racemic MixtureQ: What is
- rac-Duloxetine-d7
- rac-Duloxetine D7
- Duloxetine Racemic Mixture
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
