CAS 116834-08-3

1-PHENYL-5-(1H-PYRROL-1-YL)-1H-PYRAZOLE-4-CARBOXYLIC ACID

Description:

1-Phenyl-5-(1H-pyrrol-1-yl)-1H-pyrazole-4-carboxylic acid is a chemical compound characterized by its complex structure, which includes a pyrazole ring fused with a phenyl group and a pyrrole moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, making it of interest in medicinal chemistry. The presence of the carboxylic acid functional group suggests it can participate in various chemical reactions, including esterification and amidation. Its molecular structure may contribute to its solubility in organic solvents and its reactivity with nucleophiles. Additionally, the compound may exhibit specific pharmacological properties, which could be explored in drug development. The CAS number 116834-08-3 uniquely identifies this substance, facilitating its recognition in chemical databases and literature. Overall, this compound represents a class of organic molecules that may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and potential uses.

Formula: C₁₄H₁₀N₃O₂

InChI: InChI=1/C14H11N3O2/c18-14(19)12-10-15-17(11-6-2-1-3-7-11)13(12)16-8-4-5-9-16/h1-10H,(H,18,19)/p-1

SMILES: c1ccc(cc1)n1c(c(cn1)C(=O)[O-])n1cccc1

Synonyms:

• Rarechem Al Bo 1561
• 1-Phenyl-5-(1H-Pyrrol-1-Yl)-1H-Pyrazole-4-Carboxylicaci
• 1-phenyl-5-(1H-pyrrol-1-yl)-1H-pyrazole-4-carboxylate

1-Phenyl-5-(1H-pyrrol-1-yl)-1H-pyrazole-4-carboxylic acid

CAS: 116834-08-3

Formula: C₁₄H₁₁N₃O₂

Color and Shape: Solid

Molecular weight: 253.2560

Ref: IN-DA000DA8