CymitQuimica logo

CAS 116834-09-4

:

1-(4-chlorophenyl)-5-(1H-pyrrol-1-yl)-1H-pyrazole-4-carboxylic acid

Description:
1-(4-Chlorophenyl)-5-(1H-pyrrol-1-yl)-1H-pyrazole-4-carboxylic acid, with CAS number 116834-09-4, is a chemical compound characterized by its complex structure, which includes a pyrazole ring, a pyrrole moiety, and a carboxylic acid functional group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, making it of interest in medicinal chemistry. The presence of the 4-chlorophenyl group may influence its lipophilicity and biological interactions. The carboxylic acid group contributes to its acidity and can participate in hydrogen bonding, affecting solubility and reactivity. This compound may be studied for its potential applications in pharmaceuticals, particularly in the development of agents targeting specific biological pathways. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity would be influenced by the electronic effects of the substituents on the aromatic and heterocyclic rings. Overall, this compound represents a class of molecules that could have significant implications in drug discovery and development.
Formula:C14H10ClN3O2
InChI:InChI=1/C14H10ClN3O2/c15-10-3-5-11(6-4-10)18-13(17-7-1-2-8-17)12(9-16-18)14(19)20/h1-9H,(H,19,20)
SMILES:c1ccn(c1)c1c(cnn1c1ccc(cc1)Cl)C(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.