CymitQuimica logo

CAS 116850-44-3

:

4-methyl-3-methylsulfonyl-5-phenyl-1,2,4-triazole

Description:
4-Methyl-3-methylsulfonyl-5-phenyl-1,2,4-triazole, with the CAS number 116850-44-3, is a chemical compound that belongs to the triazole class of heterocyclic compounds. This substance features a triazole ring, which is a five-membered ring containing three nitrogen atoms and two carbon atoms, contributing to its unique chemical properties. The presence of a methylsulfonyl group enhances its solubility and reactivity, while the phenyl group can influence its biological activity and interaction with other molecules. This compound is often studied for its potential applications in agriculture, particularly as a fungicide, due to its ability to inhibit specific enzymes in fungal pathogens. Additionally, the structural modifications provided by the methyl and phenyl groups can affect its pharmacological properties, making it of interest in medicinal chemistry. Overall, 4-methyl-3-methylsulfonyl-5-phenyl-1,2,4-triazole is characterized by its heterocyclic structure, functional groups, and potential utility in various chemical and biological applications.
Formula:C10H11N3O2S
InChI:InChI=1/C10H11N3O2S/c1-13-9(8-6-4-3-5-7-8)11-12-10(13)16(2,14)15/h3-7H,1-2H3
SMILES:Cn1c(c2ccccc2)nnc1S(=O)(=O)C
Synonyms:
  • Mdl 27531
  • 4-methyl-3-(methylsulfonyl)-5-phenyl-4H-1,2,4-triazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.