CAS 116855-56-2
:4-[(ethylsulfonyl)amino]benzoic acid
Description:
4-[(Ethylsulfonyl)amino]benzoic acid, with the CAS number 116855-56-2, is an organic compound characterized by its sulfonamide functional group and a carboxylic acid moiety. This compound features a benzoic acid backbone, where an ethylsulfonyl group is attached to the para position of the amino group. The presence of the sulfonyl group enhances its solubility in polar solvents, making it useful in various chemical applications. The compound is typically a white to off-white solid and is known for its potential biological activity, which may include anti-inflammatory or analgesic properties. Its structure allows for hydrogen bonding, which can influence its reactivity and interactions with biological targets. Additionally, the compound's stability and reactivity can be affected by pH and temperature, making it important to consider these factors in practical applications. Overall, 4-[(ethylsulfonyl)amino]benzoic acid is a versatile compound with potential uses in pharmaceuticals and chemical research.
Formula:C9H11NO4S
InChI:InChI=1/C9H11NO4S/c1-2-15(13,14)10-8-5-3-7(4-6-8)9(11)12/h3-6,10H,2H2,1H3,(H,11,12)
SMILES:CCS(=O)(=O)Nc1ccc(cc1)C(=O)O
Synonyms:- Benzoic Acid, 4-[(Ethylsulfonyl)Amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-[(ethylsulfonyl)amino]benzoic acid
CAS:Formula:C9H11NO4SColor and Shape:SolidMolecular weight:229.2529
