
CAS 116856-35-0
:N-Ethyl-3-cyclopentene-1-carboxamide
Description:
N-Ethyl-3-cyclopentene-1-carboxamide is an organic compound characterized by its unique structure, which includes a cyclopentene ring and an amide functional group. This compound features an ethyl substituent on the nitrogen atom of the amide, contributing to its chemical properties. The presence of the cyclopentene ring imparts a degree of unsaturation, which can influence its reactivity and stability. Typically, compounds like N-Ethyl-3-cyclopentene-1-carboxamide may exhibit moderate polarity due to the amide group, allowing for potential hydrogen bonding interactions. This can affect its solubility in various solvents. Additionally, the compound may participate in various chemical reactions, such as nucleophilic substitutions or cycloadditions, due to the reactive nature of the cyclopentene moiety. Its applications could range from pharmaceuticals to agrochemicals, depending on its biological activity and reactivity. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its potential toxicity and environmental impact.
Formula:C8H13NO
InChI:InChI=1S/C8H13NO/c1-2-9-8(10)7-5-3-4-6-7/h3-4,7H,2,5-6H2,1H3,(H,9,10)
InChI key:InChIKey=MEDUHLFEUBSDDB-UHFFFAOYSA-N
SMILES:C(NCC)(=O)C1CC=CC1
Synonyms:- 3-Cyclopentene-1-carboxamide, N-ethyl-
- N-Ethyl-3-cyclopentene-1-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.