CAS 116857-95-5
:5-Chloro-1H-indazole-1-propanamide
Description:
5-Chloro-1H-indazole-1-propanamide is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a chlorine atom at the 5-position of the indazole ring contributes to its reactivity and potential biological activity. The propanamide functional group indicates that the compound has an amide linkage, which can influence its solubility and interaction with biological systems. This compound is often studied for its potential pharmacological properties, including anti-inflammatory and anticancer activities. Its molecular structure allows for various interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's stability, solubility, and reactivity can be influenced by the presence of the chlorine atom and the amide group, which may affect its application in drug development and research. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C10H10ClN3O
InChI:InChI=1S/C10H10ClN3O/c11-8-1-2-9-7(5-8)6-13-14(9)4-3-10(12)15/h1-2,5-6H,3-4H2,(H2,12,15)
InChI key:InChIKey=BOEZHCOICLVOTD-UHFFFAOYSA-N
SMILES:C(CC(N)=O)N1C=2C(C=N1)=CC(Cl)=CC2
Synonyms:- 1H-Indazole-1-propanamide, 5-chloro-
- 5-Chloro-1H-indazole-1-propanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
