CAS 116861-26-8

fmoc-D-serine

Description:

Fmoc-D-serine is a derivative of the amino acid D-serine, characterized by the presence of a 9-fluorenylmethoxycarbonyl (Fmoc) protecting group. This compound is commonly used in peptide synthesis, particularly in solid-phase peptide synthesis, due to its ability to protect the amino group while allowing for further reactions at the carboxyl group. Fmoc-D-serine is typically a white to off-white solid and is soluble in organic solvents such as dimethylformamide (DMF) and dimethyl sulfoxide (DMSO), but less soluble in water. The Fmoc group can be removed under basic conditions, facilitating the subsequent coupling of D-serine into peptides. This compound is of interest not only in synthetic chemistry but also in biochemical research, as D-serine plays a role in neurotransmission and is involved in various physiological processes. Its unique properties make it a valuable building block in the design of bioactive peptides and pharmaceuticals.

Formula: C₁₈H₁₇NO₅

InChI: InChI=1/C18H17NO5/c20-9-16(17(21)22)19-18(23)24-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15-16,20H,9-10H2,(H,19,23)(H,21,22)/t16-/m1/s1

SMILES: c1ccc2c(c1)c1ccccc1C2COC(=N[C@H](CO)C(=O)O)O

Synonyms:

• Fmoc-D-Ser-OH
• N-[(9H-fluoren-9-ylmethoxy)carbonyl]-D-serine

D-Serine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-

CAS: 116861-26-8

Formula: C₁₈H₁₇NO₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 327.3313

Ref: IN-DA000DCH

Fmoc-D-Ser-OH

CAS: 116861-26-8

Fmoc-D-Ser-OH

Purity: 98%

Molecular weight: 327.33g/mol

Ref: 54-OR1013353

Fmoc-D-Ser-OH

CAS: 116861-26-8

Molecular weight: 327.33

Ref: 7W-GM3709

Fmoc-D-Ser-OH

CAS: 116861-26-8

M06262 - Fmoc-D-Ser-OH

Formula: C₁₈H₁₇NO₅

Purity: 95%

Color and Shape: Solid

Molecular weight: 327.336

Ref: 10-M06262

FMOC-D-Serine extrapure, 99%

CAS: 116861-26-8

Formula: C₁₈H₁₇NO₅

Purity: min 99.0%

Color and Shape: White to slight yellow to beige, Powder, Clear, Colourless to pale yellow

Molecular weight: 327.34

Ref: SR-53534