CAS 116889-64-6
:1-Methyl-4-(2H-tetrazol-5-yl)-1H-pyrazol-5-amine
Description:
1-Methyl-4-(2H-tetrazol-5-yl)-1H-pyrazol-5-amine, with the CAS number 116889-64-6, is a chemical compound characterized by its unique structure that includes both a pyrazole and a tetrazole moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents. It is known for its biological activity, often studied for its role in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the tetrazole ring contributes to its potential as a bioisostere for carboxylic acids, enhancing its pharmacological properties. Additionally, the methyl group on the pyrazole ring can influence its lipophilicity and overall reactivity. The compound may also exhibit various functional properties, including potential interactions with biological targets, making it of interest in drug discovery and development. As with many nitrogen-containing heterocycles, it may also display interesting coordination chemistry with metal ions, which can be relevant in various applications.
Formula:C5H7N7
InChI:InChI=1S/C5H7N7/c1-12-4(6)3(2-7-12)5-8-10-11-9-5/h2H,6H2,1H3,(H,8,9,10,11)
InChI key:InChIKey=GCRANKPLOKKLTB-UHFFFAOYSA-N
SMILES:NC1=C(C=NN1C)C=2NN=NN2
Synonyms:- 1H-Pyrazol-5-amine, 1-methyl-4-(2H-tetrazol-5-yl)-
- 1-Methyl-4-(2H-tetrazol-5-yl)-1H-pyrazol-5-amine
- 1-Methyl-4-(1H-1,2,3,4-tetrazol-5-yl)-1H-pyrazol-5-amine
- 1H-Pyrazol-5-amine, 1-methyl-4-(1H-tetrazol-5-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
