CAS 1169-70-6: N-Phenyl-N-[1-(2-phenylethyl)-4-piperidinyl]butanamide
Description:N-Phenyl-N-[1-(2-phenylethyl)-4-piperidinyl]butanamide, with the CAS number 1169-70-6, is a chemical compound that belongs to the class of piperidine derivatives. This substance is characterized by its complex structure, which includes a piperidine ring, a butanamide moiety, and phenyl groups that contribute to its lipophilicity and potential biological activity. It is often studied for its pharmacological properties, particularly in relation to its interactions with neurotransmitter systems. The compound may exhibit various effects on the central nervous system, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Overall, N-Phenyl-N-[1-(2-phenylethyl)-4-piperidinyl]butanamide represents a significant area of research in the field of pharmacology and organic synthesis.
Formula:C23H30N2O
InChI:InChI=1S/C23H30N2O/c1-2-9-23(26)25(21-12-7-4-8-13-21)22-15-18-24(19-16-22)17-14-20-10-5-3-6-11-20/h3-8,10-13,22H,2,9,14-19H2,1H3
InChI key:InChIKey=QQOMYEQLWQJRKK-UHFFFAOYSA-N
SMILES:O=C(N(C=1C=CC=CC1)C2CCN(CCC=3C=CC=CC3)CC2)CCC
- Synonyms:
- Butyranilide, N-(1-phenethyl-4-piperidyl)-
- Butyrfentanyl
- N-Phenyl-N-[1-(2-phenylethyl)-4-piperidinyl]butanamide
- Butyryl fentanyl
- Butanamide, N-phenyl-N-[1-(2-phenylethyl)-4-piperidinyl]-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Butyrfentanyl (Butyrylfentanyl) REF: 86-MM0528.20-0025CAS: 1169-70-6 | - - - | To inquire | Wed 12 Mar 25 |
![]() | Butyrfentanyl REF: TR-B802725CAS: 1169-70-6 | - - - | 346.00 €~1,113.00 € | Wed 19 Mar 25 |

Butyrfentanyl (Butyrylfentanyl)
Controlled ProductRef: 86-MM0528.20-0025
25mg | To inquire |

Butyrfentanyl
Controlled ProductRef: TR-B802725
10mg | 1,113.00 € | ||
2500µg | 346.00 € |