CAS 116910-31-7
:Tetradecyl 4-chloro-4-oxobutanoate
Description:
Tetradecyl 4-chloro-4-oxobutanoate, with the CAS number 116910-31-7, is an organic compound characterized by its ester functional group and a long-chain alkyl moiety. This substance features a tetradecyl group, which contributes to its hydrophobic properties, making it less soluble in water but more soluble in organic solvents. The presence of the 4-chloro and 4-oxo functional groups indicates that it has potential reactivity, particularly in nucleophilic substitution reactions due to the electrophilic nature of the carbonyl carbon. Its structure suggests that it may exhibit surfactant properties, which can be useful in various applications, including emulsification and solubilization processes. Additionally, the compound may have implications in the fields of pharmaceuticals or agrochemicals, given the presence of the chloro and keto functionalities, which can influence biological activity. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or environmental impact. Overall, Tetradecyl 4-chloro-4-oxobutanoate is a compound of interest for its unique structural features and potential applications.
Formula:C18H33ClO3
InChI:InChI=1S/C18H33ClO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-22-18(21)15-14-17(19)20/h2-16H2,1H3
InChI key:InChIKey=RXXJWCLDEDGGIW-UHFFFAOYSA-N
SMILES:O(CCCCCCCCCCCCCC)C(CCC(Cl)=O)=O
Synonyms:- Tetradecyl 4-chloro-4-oxobutanoate
- Butanoic acid, 4-chloro-4-oxo-, tetradecyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
