CAS 116922-61-3
:4-FLUORO-3-(TRIMETHYLSILYL)PYRIDINE
Description:
4-Fluoro-3-(trimethylsilyl)pyridine is an organofluorine compound characterized by the presence of a fluorine atom and a trimethylsilyl group attached to a pyridine ring. The molecular structure features a six-membered aromatic ring with nitrogen, which contributes to its basicity and potential reactivity. The trimethylsilyl group enhances the compound's lipophilicity and stability, making it useful in various synthetic applications, particularly in organic synthesis and as a protecting group in chemical reactions. The fluorine substituent can influence the electronic properties of the molecule, potentially affecting its reactivity and interaction with other chemical species. This compound is typically used in research and development, particularly in the fields of medicinal chemistry and materials science. Its unique properties may also make it suitable for applications in agrochemicals or pharmaceuticals, where modifications to the pyridine structure can lead to enhanced biological activity or selectivity. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C8H12FNSi
InChI:InChI=1/C8H12FNSi/c1-11(2,3)8-6-10-5-4-7(8)9/h4-6H,1-3H3
SMILES:C[Si](C)(C)c1cnccc1F
Synonyms:- Pyridine, 4-Fluoro-3-(Trimethylsilyl)-
- 4-FLUORO-3-(TRIMETHYLSILYL)PYRIDINE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
