CAS 116950-01-7
:(2S,3S,8ar)-2-phenyl- 3-hydroxymethyl-8A-methyl bicyclic lactam
Description:
The chemical substance known as (2S,3S,8ar)-2-phenyl-3-hydroxymethyl-8A-methyl bicyclic lactam, with the CAS number 116950-01-7, is a bicyclic lactam characterized by its specific stereochemistry and functional groups. This compound features a bicyclic structure that includes a lactam ring, which is a cyclic amide formed by the condensation of an amino acid. The presence of a phenyl group and a hydroxymethyl group contributes to its unique reactivity and potential biological activity. The stereochemistry indicated by the (2S,3S,8ar) configuration suggests specific spatial arrangements of the substituents, which can significantly influence the compound's interactions in biological systems. Bicyclic lactams are often of interest in medicinal chemistry due to their potential as pharmacophores, and this particular compound may exhibit properties relevant to drug development or therapeutic applications. Its solubility, stability, and reactivity would depend on the specific conditions and environment in which it is studied.
Formula:C15H19NO3
InChI:InChI=1/C15H19NO3/c1-15-9-5-8-13(18)16(15)12(10-17)14(19-15)11-6-3-2-4-7-11/h2-4,6-7,12,14,17H,5,8-10H2,1H3/t12-,14-,15+/m0/s1
Synonyms:- hexahydro-3-(hydroxymethyl)-8A-methyl-2-phenyl-ox
- [2S-(2alpha,3beta,8abeta)]-(+)-Hexahydro-3-(hydroxymethyl)-8a-methyl-2-phenyl-5H-oxazolo[3,2-a]pyridin-5-one
- (2S,3S,8aR)-3-(hydroxymethyl)-8a-methyl-2-phenylhexahydro-5H-[1,3]oxazolo[3,2-a]pyridin-5-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(Hydroxymethyl)-8a-methyl-2-phenyltetrahydro-2H-oxazolo[3,2-a]pyridin-5(3H)-one
CAS:Formula:C15H19NO3Molecular weight:261.3163
