CAS 116964-03-5
:2-acetyl-3,5,6-trihydroxyphenyl beta-D-glucopyranoside
Description:
2-Acetyl-3,5,6-trihydroxyphenyl beta-D-glucopyranoside is a glycoside compound characterized by its phenolic structure and sugar moiety. It features a phenolic ring with three hydroxyl groups at the 3, 5, and 6 positions, contributing to its potential antioxidant properties. The acetyl group at the 2-position enhances its solubility and reactivity. The beta-D-glucopyranoside part indicates that it is a glycoside, where the sugar component is a beta-anomer of D-glucose, which can influence its biological activity and interactions. This compound may exhibit various biological activities, including anti-inflammatory and antimicrobial effects, due to the presence of the hydroxyl groups. Its structural characteristics suggest potential applications in pharmaceuticals, food science, and natural product chemistry. Additionally, the presence of multiple hydroxyl groups can facilitate hydrogen bonding, affecting its solubility and stability in different solvents. Overall, 2-acetyl-3,5,6-trihydroxyphenyl beta-D-glucopyranoside represents a complex molecule with diverse chemical properties and potential applications.
Formula:C14H18O10
InChI:InChI=1/C14H18O10/c1-4(16)8-5(17)2-6(18)9(19)13(8)24-14-12(22)11(21)10(20)7(3-15)23-14/h2,7,10-12,14-15,17-22H,3H2,1H3/t7-,10-,11+,12-,14+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Lalioside
CAS:Lalioside is a natural glycoside product, which is derived from the plant Ilex paraguariensis, commonly known as yerba maté. It is a triterpene saponin specifically isolated from the leaves of this plant. The mode of action of lalioside involves its biochemical activity as a neuroprotective agent, where it interferes with pathways linked to oxidative stress and apoptosis. Studies suggest that it modulates certain cellular mechanisms, contributing to its potential protective effects on neural cells.
Formula:C14H18O10Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:346.29 g/molLalioside
CAS:Lalioside is a potent accelerator of neurite outgrowth.Formula:C14H18O10Color and Shape:SolidMolecular weight:346.29

