
CAS 116964-16-0
:1-[6-[(3-Acetyl-2,4-dihydroxy-6-methoxy-5-methylphenyl)methyl]-5,7-dihydroxy-2,2-dimethyl-2H-1-benzopyran-8-yl]-2-methyl-1-propanone
Description:
1-[6-[(3-Acetyl-2,4-dihydroxy-6-methoxy-5-methylphenyl)methyl]-5,7-dihydroxy-2,2-dimethyl-2H-1-benzopyran-8-yl]-2-methyl-1-propanone, with CAS number 116964-16-0, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as ketones, hydroxyls, and methoxy groups. This compound belongs to the class of flavonoids, which are known for their diverse biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties. The presence of acetyl and methoxy substituents enhances its solubility and reactivity, making it of interest in medicinal chemistry and natural product research. Its structural features suggest potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, this compound exemplifies the complexity and potential utility of flavonoid derivatives in various scientific fields.
Formula:C26H30O8
InChI:InChI=1S/C26H30O8/c1-11(2)19(28)18-22(31)15(21(30)14-8-9-26(5,6)34-25(14)18)10-16-23(32)17(13(4)27)20(29)12(3)24(16)33-7/h8-9,11,29-32H,10H2,1-7H3
InChI key:InChIKey=BYAZINICHUCWIL-UHFFFAOYSA-N
SMILES:C(C(C)C)(=O)C1=C2C(=C(O)C(CC3=C(OC)C(C)=C(O)C(C(C)=O)=C3O)=C1O)C=CC(C)(C)O2
Synonyms:- Isobutyrylmallotochromene
- 1-[6-[(3-Acetyl-2,4-dihydroxy-6-methoxy-5-methylphenyl)methyl]-5,7-dihydroxy-2,2-dimethyl-2H-1-benzopyran-8-yl]-2-methyl-1-propanone
- 1-Propanone, 1-[6-[(3-acetyl-2,4-dihydroxy-6-methoxy-5-methylphenyl)methyl]-5,7-dihydroxy-2,2-dimethyl-2H-1-benzopyran-8-yl]-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Propanone, 1-[6-[(3-acetyl-2,4-dihydroxy-6-methoxy-5-methylphenyl)methyl]-5,7-dihydroxy-2,2-dimethyl-2H-1-benzopyran-8-yl]-2-methyl-
CAS:Formula:C26H30O8Molecular weight:470.5116
