CAS 1169748-84-8: B-(5-Amino-3-pyridinyl)boronic acid
Description:B-(5-Amino-3-pyridinyl)boronic acid is an organic compound characterized by the presence of a boronic acid functional group and a pyridine ring substituted with an amino group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and organic synthesis. The amino group on the pyridine ring enhances its solubility in polar solvents and may participate in hydrogen bonding, influencing its reactivity and interaction with biological targets. Additionally, the presence of the pyridine moiety can contribute to the compound's electronic properties, potentially affecting its role as a ligand in coordination chemistry. B-(5-Amino-3-pyridinyl)boronic acid is often studied for its potential applications in drug development, particularly in the context of targeting specific enzymes or receptors. Its unique structural features make it a valuable compound in the field of chemical biology and materials science.
Formula:C5H7BN2O2
InChI:InChI=1S/C5H7BN2O2/c7-5-1-4(6(9)10)2-8-3-5/h1-3,9-10H,7H2
InChI key:InChIKey=RKZHYRRFTYDWTH-UHFFFAOYSA-N
SMILES:OB(O)C=1C=NC=C(N)C1
- Synonyms:
- 3-Aminopyridine-5-boronic acid
- 5-Aminopyridin-3-ylboronic acid
- B-(5-Amino-3-pyridinyl)boronic acid
- Boronic acid, B-(5-amino-3-pyridinyl)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Boronic acid, B-(5-amino-3-pyridinyl)- REF: IN-DA000DFFCAS: 1169748-84-8 | 97% | To inquire | Wed 26 Mar 25 |
![]() | (5-Aminopyridin-3-yl)boronic acid REF: 10-F235105CAS: 1169748-84-8 | 95.0% | 95.00 €~1,058.00 € | Mon 31 Mar 25 |
![]() | (5-Aminopyridin-3-yl)boronic acid REF: 54-OR907488CAS: 1169748-84-8 | 0.98 | 95.00 €~887.00 € | Wed 02 Apr 25 |
![]() | (5-Aminopyridin-3-yl)boronic acid REF: 3D-FA141361CAS: 1169748-84-8 | Min. 95% | - - - | Discontinued product |

Boronic acid, B-(5-amino-3-pyridinyl)-
Ref: IN-DA000DFF
1g | 186.00 € | ||
100mg | 97.00 € | ||
250mg | 120.00 € |

(5-Aminopyridin-3-yl)boronic acid
Ref: 10-F235105
1g | 279.00 € | ||
5g | 1,058.00 € | ||
100mg | 95.00 € | ||
250mg | 137.00 € |

Ref: 54-OR907488
1g | 309.00 € | ||
5g | 887.00 € | ||
100mg | 95.00 € | ||
250mg | 142.00 € |

(5-Aminopyridin-3-yl)boronic acid
Ref: 3D-FA141361
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |