CAS 116975-14-5
:4-deuteriopyridine-3-carboxylic acid
Description:
4-Deuteriopyridine-3-carboxylic acid is a deuterated derivative of pyridine-3-carboxylic acid, characterized by the presence of a deuterium atom at the 4-position of the pyridine ring. This compound features a pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom, and a carboxylic acid functional group (-COOH) at the 3-position. The incorporation of deuterium, a stable isotope of hydrogen, can influence the compound's physical and chemical properties, such as its reactivity and isotopic labeling in various applications, including NMR spectroscopy and kinetic studies. 4-Deuteriopyridine-3-carboxylic acid is typically used in research settings, particularly in studies involving drug development, biochemical pathways, and as a building block in organic synthesis. Its unique isotopic composition allows for enhanced tracking and analysis in complex chemical environments. As with many organic compounds, it is important to handle it with care, following appropriate safety protocols.
Formula:C6H4DNO2
InChI:InChI=1/C6H5NO2/c8-6(9)5-2-1-3-7-4-5/h1-4H,(H,8,9)/i2D
SMILES:c1c(c(cnc1)C(=O)O)[2H]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
