CAS 1169788-32-2

6-Nitro-4-(trifluoromethyl)-1H-indazole

Description:

6-Nitro-4-(trifluoromethyl)-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a nitro group at the 6-position and a trifluoromethyl group at the 4-position significantly influences its chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The trifluoromethyl group enhances lipophilicity and can affect the compound's biological activity, making it of interest in pharmaceutical research. The nitro group can participate in various chemical reactions, including reduction and nucleophilic substitution. Additionally, the compound may exhibit unique spectroscopic properties, making it suitable for analytical studies. Its CAS number, 1169788-32-2, allows for precise identification in chemical databases. Overall, 6-Nitro-4-(trifluoromethyl)-1H-indazole is a compound of interest in both synthetic chemistry and medicinal chemistry due to its structural features and potential applications.

Formula: C₈H₄F₃N₃O₂

InChI: InChI=1S/C8H4F3N3O2/c9-8(10,11)6-1-4(14(15)16)2-7-5(6)3-12-13-7/h1-3H,(H,12,13)

InChI key: InChIKey=OQSAMGQYHIMFPN-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C2C(=CC(N(=O)=O)=C1)NN=C2

Synonyms:

• 6-Nitro-4-trifluoromethyl-1H-indazole
• 1H-Indazole, 6-nitro-4-(trifluoromethyl)-
• 6-Nitro-4-(trifluoromethyl)-1H-indazole

6-Nitro-4-(trifluoromethyl)-1H-indazole

CAS: 1169788-32-2

Versatile small molecule scaffold

Formula: C₈H₄F₃N₃O₂

Purity: Min. 95%

Molecular weight: 231.13 g/mol

Ref: 3D-UWB78832