CAS 116986-14-2
:3-(Bromomethyl)-4-pyridinecarbonitrile
Description:
3-(Bromomethyl)-4-pyridinecarbonitrile is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromomethyl group indicates that a bromine atom is attached to a methylene (-CH2-) group, which is further connected to the pyridine ring. Additionally, the compound features a cyano group (-C≡N) at the 4-position of the pyridine, contributing to its reactivity and potential applications in organic synthesis. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its structure suggests potential use in pharmaceuticals, agrochemicals, or as an intermediate in the synthesis of more complex molecules. The presence of both the bromine and cyano functional groups can facilitate nucleophilic substitution reactions, making it a valuable building block in synthetic organic chemistry. Safety precautions should be taken when handling this compound due to the toxicity associated with brominated compounds and nitriles.
Formula:C7H5BrN2
InChI:InChI=1S/C7H5BrN2/c8-3-7-5-10-2-1-6(7)4-9/h1-2,5H,3H2
InChI key:InChIKey=WETPQJZGSNAKCG-UHFFFAOYSA-N
SMILES:C(#N)C=1C(CBr)=CN=CC1
Synonyms:- 3-(Bromomethyl)-4-pyridinecarbonitrile
- 3-(Bromomethyl)-4-cyanopyridine
- 4-Pyridinecarbonitrile, 3-(bromomethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
