CAS 1169977-62-1

Ethyl 1-(5-bromo-2-pyrimidinyl)-4-piperidinecarboxylate

Description:

Ethyl 1-(5-bromo-2-pyrimidinyl)-4-piperidinecarboxylate is a chemical compound characterized by its unique structure, which includes a pyrimidine ring substituted with a bromine atom and a piperidine moiety. This compound typically exhibits properties associated with both heterocyclic and aliphatic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The bromine substituent can enhance the compound's biological activity and influence its interaction with various biological targets. Ethyl 1-(5-bromo-2-pyrimidinyl)-4-piperidinecarboxylate may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential as a scaffold for drug design. Additionally, its synthesis may involve standard organic reactions such as nucleophilic substitution and esterification. As with many chemical substances, safety precautions should be observed when handling this compound, including the use of appropriate personal protective equipment and adherence to safety data sheet guidelines.

Formula: C₁₂H₁₆BrN₃O₂

InChI: InChI=1S/C12H16BrN3O2/c1-2-18-11(17)9-3-5-16(6-4-9)12-14-7-10(13)8-15-12/h7-9H,2-6H2,1H3

InChI key: InChIKey=CDNBEUWALNYVAY-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1CCN(CC1)C=2N=CC(Br)=CN2

Synonyms:

• 4-Piperidinecarboxylic acid, 1-(5-bromo-2-pyrimidinyl)-, ethyl ester
• Ethyl 1-(5-bromo-2-pyrimidinyl)-4-piperidinecarboxylate