CAS 117-01-1
:2-amino-1-bromo-3-chloroanthracene-9,10-dione
Description:
2-Amino-1-bromo-3-chloroanthracene-9,10-dione, with the CAS number 117-01-1, is a synthetic organic compound belonging to the class of anthraquinones. This compound features a complex aromatic structure characterized by the presence of an amino group, a bromo substituent, and a chloro substituent, which contribute to its reactivity and potential applications in various fields. It typically exhibits a deep color, often associated with its conjugated system, which can absorb light in the visible spectrum. The presence of halogen atoms (bromine and chlorine) enhances its electrophilic properties, making it useful in organic synthesis and as a dye. Additionally, the amino group can participate in hydrogen bonding and nucleophilic reactions, further expanding its utility in chemical reactions. This compound is of interest in research related to organic electronics, photochemistry, and as a potential intermediate in the synthesis of more complex molecules. Safety precautions should be taken when handling this substance, as it may pose health risks due to its chemical nature.
Formula:C14H7BrClNO2
InChI:InChI=1/C14H7BrClNO2/c15-11-10-8(5-9(16)12(11)17)13(18)6-3-1-2-4-7(6)14(10)19/h1-5H,17H2
SMILES:c1ccc2c(c1)C(=O)c1cc(c(c(c1C2=O)Br)N)Cl
Synonyms:- 2-Amino-1-bromo-3-chloro-9,10-anthraquinone
- 2-Amino-1-bromo-3-chloro-anthraquinone
- 9,10-Anthracenedione, 2-Amino-1-Bromo-3-Chloro-
- Anthraquinone, 2-amino-1-bromo-3-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
