
CAS 117-05-5
:N-(5-Chloro-9,10-dihydro-9,10-dioxo-1-anthracenyl)benzamide
Description:
N-(5-Chloro-9,10-dihydro-9,10-dioxo-1-anthracenyl)benzamide, with the CAS number 117-05-5, is a chemical compound that belongs to the class of anthraquinone derivatives. This substance features a complex structure characterized by an anthracene core, which is a polycyclic aromatic hydrocarbon, modified with a benzamide functional group and a chlorine atom. The presence of the 9,10-dioxo groups indicates that it has two carbonyl functionalities, contributing to its reactivity and potential applications in various chemical processes. The chlorine substituent enhances its electrophilic properties, making it useful in organic synthesis and potentially in dye applications. This compound is typically characterized by its solid state at room temperature, with specific melting and boiling points that reflect its molecular interactions. Its solubility varies depending on the solvent, and it may exhibit fluorescence, which is a common property of many aromatic compounds. Overall, N-(5-Chloro-9,10-dihydro-9,10-dioxo-1-anthracenyl)benzamide is of interest in both academic research and industrial applications due to its unique chemical properties.
Formula:C21H12ClNO3
InChI:InChI=1S/C21H12ClNO3/c22-15-10-4-8-13-17(15)19(24)14-9-5-11-16(18(14)20(13)25)23-21(26)12-6-2-1-3-7-12/h1-11H,(H,23,26)
InChI key:InChIKey=VDCUNNJIPITONP-UHFFFAOYSA-N
SMILES:N(C(=O)C1=CC=CC=C1)C2=C3C(C(=O)C=4C(C3=O)=CC=CC4Cl)=CC=C2
Synonyms:- 1-Benzamido-5-chloro-9,10-anthraquinone
- Anthraquinone, 1-benzamido-5-chloro-
- Benzamide, N-(5-chloro-1-anthraquinonyl)-
- N-(5-Chloro-9,10-dihydro-9,10-dioxo-1-anthracenyl)benzamide
- Benzamide, N-(5-chloro-9,10-dihydro-9,10-dioxo-1-anthracenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzamide, N-(5-chloro-9,10-dihydro-9,10-dioxo-1-anthracenyl)-
CAS:Formula:C21H12ClNO3Molecular weight:361.7779
