
CAS 117-13-5
:5-Amino-8-bromo-9,10-dihydro-9,10-dioxo-1,6-anthracenedisulfonic acid
Description:
5-Amino-8-bromo-9,10-dihydro-9,10-dioxo-1,6-anthracenedisulfonic acid, with CAS number 117-13-5, is a synthetic organic compound belonging to the anthraquinone family. This compound features multiple functional groups, including amino and sulfonic acid groups, which contribute to its solubility in water and its potential applications in dye chemistry and as a pH indicator. The presence of bromine and the dioxo groups enhances its reactivity and stability, making it useful in various chemical reactions. Its structure allows for strong interactions with biological molecules, which can be leveraged in biochemical applications. Additionally, the sulfonic acid groups impart acidic properties, influencing its behavior in different pH environments. This compound is often utilized in the synthesis of dyes and pigments, particularly in textile and paper industries, due to its vibrant color and stability. Safety considerations should be taken into account when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C14H8BrNO8S2
InChI:InChI=1S/C14H8BrNO8S2/c15-6-4-8(26(22,23)24)12(16)11-10(6)14(18)9-5(13(11)17)2-1-3-7(9)25(19,20)21/h1-4H,16H2,(H,19,20,21)(H,22,23,24)
InChI key:InChIKey=OEBFYWPAABOJCP-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C1=C2C(C(=O)C=3C(C2=O)=C(Br)C=C(S(=O)(=O)O)C3N)=CC=C1
Synonyms:- 5-Amino-8-bromo-9,10-dihydro-9,10-dioxo-1,6-anthracenedisulfonic acid
- 1,6-Anthracenedisulfonic acid, 5-amino-8-bromo-9,10-dihydro-9,10-dioxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,6-Anthracenedisulfonic acid, 5-amino-8-bromo-9,10-dihydro-9,10-dioxo-
CAS:Formula:C14H8BrNO8S2Molecular weight:462.2492
