CAS 117-38-4
:1-[(2,3-Dihydro-1,5-dimethyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)amino]methanesulfonic acid
Description:
1-[(2,3-Dihydro-1,5-dimethyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)amino]methanesulfonic acid, with the CAS number 117-38-4, is a chemical compound characterized by its complex structure, which includes a pyrazole ring and a methanesulfonic acid moiety. This compound typically exhibits properties such as solubility in polar solvents due to the presence of the sulfonic acid group, which enhances its ionic character. It may also display biological activity, potentially serving as a pharmaceutical intermediate or a research chemical. The presence of the pyrazole ring suggests possible applications in medicinal chemistry, particularly in the development of drugs targeting various biological pathways. Additionally, the compound's stability and reactivity can be influenced by the substituents on the pyrazole ring, which may affect its interaction with other chemical entities. Overall, this compound is of interest in both synthetic and medicinal chemistry due to its unique structural features and potential applications.
Formula:C12H15N3O4S
InChI:InChI=1S/C12H15N3O4S/c1-9-11(13-8-20(17,18)19)12(16)15(14(9)2)10-6-4-3-5-7-10/h3-7,13H,8H2,1-2H3,(H,17,18,19)
InChI key:InChIKey=VRESBCAKEFFDQB-UHFFFAOYSA-N
SMILES:O=C1N(N(C)C(C)=C1NCS(=O)(=O)O)C2=CC=CC=C2
Synonyms:- 1-[(2,3-Dihydro-1,5-dimethyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)amino]methanesulfonic acid
- Methanesulfonic acid, 1-[(2,3-dihydro-1,5-dimethyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)amino]-
- Methanesulfonic acid, [(2,3-dihydro-1,5-dimethyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)amino]-
- Methanesulfonic acid, (antipyrinylamino)-
- (Antipyrinylamino)methanesulfonic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Metamizole EP impurity E
CAS:Metamizole EP impurity E is a synthetic research and development impurity standard for the drug product. Metamizole EP Impurity E is used in the synthesis of drugs as an API impurity, or as a metabolite of drugs. The chemical purity is typically greater than 98%. Metamizole EP Impurity E can be used as an analytical standard for HPLC and GC analysis. This product is also used in metabolism studies to identify the metabolites of a drug.
Formula:C12H15N3O4SPurity:Min. 95%Color and Shape:PowderMolecular weight:297.33 g/molMetamizole EP Impurity E
CAS:Formula:C12H15N3O4SColor and Shape:White To Off-White SolidMolecular weight:297.33Ref: 4Z-M-538
Discontinued product


