
CAS 117-44-2
:4-[2-(4-Amino-5-methoxy-2-methylphenyl)diazenyl]-5-[(phenylsulfonyl)oxy]-2,7-naphthalenedisulfonic acid
Description:
The chemical substance known as 4-[2-(4-Amino-5-methoxy-2-methylphenyl)diazenyl]-5-[(phenylsulfonyl)oxy]-2,7-naphthalenedisulfonic acid, with the CAS number 117-44-2, is a synthetic organic compound primarily used in dye chemistry and as a colorant in various applications. It features a complex structure characterized by a naphthalene backbone with multiple sulfonic acid groups, which enhance its solubility in water and contribute to its functionality as a dye. The presence of the diazenyl group indicates that it can form azo dyes, which are known for their vibrant colors. Additionally, the amino and methoxy substituents on the aromatic ring can influence the compound's reactivity and stability. This compound is typically utilized in textile dyeing, as well as in biological and analytical applications due to its ability to form stable complexes with metal ions. Safety data should be consulted, as azo compounds can sometimes release aromatic amines, which may pose health risks.
Formula:C24H21N3O10S3
InChI:InChI=1S/C24H21N3O10S3/c1-14-8-19(25)22(36-2)13-20(14)26-27-21-11-17(38(28,29)30)9-15-10-18(39(31,32)33)12-23(24(15)21)37-40(34,35)16-6-4-3-5-7-16/h3-13H,25H2,1-2H3,(H,28,29,30)(H,31,32,33)
InChI key:InChIKey=QEYCCMMMEKIJFH-UHFFFAOYSA-N
SMILES:O(S(=O)(=O)C1=CC=CC=C1)C=2C3=C(C=C(S(=O)(=O)O)C2)C=C(S(=O)(=O)O)C=C3N=NC4=CC(OC)=C(N)C=C4C
Synonyms:- 2,7-Naphthalenedisulfonic acid, 4-[(4-amino-5-methoxy-o-tolyl)azo]-5-hydroxy-, benzenesulfonate (ester)
- 2,7-Naphthalenedisulfonic acid, 4-[(4-amino-5-methoxy-2-methylphenyl)azo]-5-[(phenylsulfonyl)oxy]-
- 4-[2-(4-Amino-5-methoxy-2-methylphenyl)diazenyl]-5-[(phenylsulfonyl)oxy]-2,7-naphthalenedisulfonic acid
- 2,7-Naphthalenedisulfonic acid, 4-[2-(4-amino-5-methoxy-2-methylphenyl)diazenyl]-5-[(phenylsulfonyl)oxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,7-Naphthalenedisulfonic acid, 4-[2-(4-amino-5-methoxy-2-methylphenyl)diazenyl]-5-[(phenylsulfonyl)oxy]-
CAS:Formula:C24H21N3O10S3Molecular weight:607.6326
